C27H26BrFeNO+2 — CID 54752337
CID 54752337 (PubChem CID 54752337) has the molecular formula C27H26BrFeNO+2 and a molecular weight of 516.26 g/mol.
| Compound Name | CID 54752337 |
|---|---|
| PubChem CID | 54752337 |
| Molecular Formula | C27H26BrFeNO+2 |
| Molecular Weight | 516.26 g/mol |
| Exact Mass | 515.05 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC(c1ccc(Br)cc1)=CC2[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C22H21BrNO.C5H5.Fe/c1-22(2)12-19-21(20(25)13-22)17(14-5-3-4-6-14)11-18(24-19)15-7-9-16(23)10-8-15;1-2-4-5-3-1;/h3-11,17,24H,12-13H2,1-2H3;1-5H;/q;;+2 |
| InChIKey | ZMNRGQYCSZQNDP-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.26 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|