C22H23N3O3 — CID 98152726
N-[(Z)-[(2S,3R)-6,6-dimethyl-2-nitro-3-phenyl-2,3,5,7-tetrahydro-1-benzofuran-4-ylidene]amino]aniline (PubChem CID 98152726) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[(Z)-[(2S,3R)-6,6-dimethyl-2-nitro-3-phenyl-2,3,5,7-tetrahydro-1-benzofuran-4-ylidene]amino]aniline.
| Compound Name | N-[(Z)-[(2S,3R)-6,6-dimethyl-2-nitro-3-phenyl-2,3,5,7-tetrahydro-1-benzofuran-4-ylidene]amino]aniline |
|---|---|
| PubChem CID | 98152726 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[(Z)-[(2S,3R)-6,6-dimethyl-2-nitro-3-phenyl-2,3,5,7-tetrahydro-1-benzofuran-4-ylidene]amino]aniline |
| SMILES | CC1(C)CC2=C(/C(=N\Nc3ccccc3)C1)[C@@H](c1ccccc1)[C@@H]([N+](=O)[O-])O2 |
| InChI | InChI=1S/C22H23N3O3/c1-22(2)13-17(24-23-16-11-7-4-8-12-16)20-18(14-22)28-21(25(26)27)19(20)15-9-5-3-6-10-15/h3-12,19,21,23H,13-14H2,1-2H3/b24-17-/t19-,21+/m1/s1 |
| InChIKey | YCTTYYZDQYBKMX-YYOZNPJUSA-N |
| XLogP | 4.95 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|