C20H18N4O5 — CID 98152730
N-[(Z)-[(2R,3R)-2-nitro-3-(4-nitrophenyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-ylidene]amino]aniline (PubChem CID 98152730) has the molecular formula C20H18N4O5 and a molecular weight of 394.39 g/mol. Its IUPAC name is N-[(Z)-[(2R,3R)-2-nitro-3-(4-nitrophenyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-ylidene]amino]aniline.
| Compound Name | N-[(Z)-[(2R,3R)-2-nitro-3-(4-nitrophenyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-ylidene]amino]aniline |
|---|---|
| PubChem CID | 98152730 |
| Molecular Formula | C20H18N4O5 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-[(Z)-[(2R,3R)-2-nitro-3-(4-nitrophenyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-ylidene]amino]aniline |
| SMILES | O=[N+]([O-])c1ccc([C@@H]2C3=C(CCC/C3=N/Nc3ccccc3)O[C@H]2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H18N4O5/c25-23(26)15-11-9-13(10-12-15)18-19-16(22-21-14-5-2-1-3-6-14)7-4-8-17(19)29-20(18)24(27)28/h1-3,5-6,9-12,18,20-21H,4,7-8H2/b22-16-/t18-,20-/m1/s1 |
| InChIKey | PCCWWUSSXJZSRG-ZPVMMASFSA-N |
| XLogP | 4.22 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|