C22H18N4O5 — CID 135457881
N-[(8E)-8-[(4-nitrophenyl)hydrazinylidene]-2-oxo-6,7-dihydro-5H-chromen-3-yl]benzamide (PubChem CID 135457881) has the molecular formula C22H18N4O5 and a molecular weight of 418.41 g/mol. Its IUPAC name is N-[(8E)-8-[(4-nitrophenyl)hydrazinylidene]-2-oxo-6,7-dihydro-5H-chromen-3-yl]benzamide.
| Compound Name | N-[(8E)-8-[(4-nitrophenyl)hydrazinylidene]-2-oxo-6,7-dihydro-5H-chromen-3-yl]benzamide |
|---|---|
| PubChem CID | 135457881 |
| Molecular Formula | C22H18N4O5 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N-[(8E)-8-[(4-nitrophenyl)hydrazinylidene]-2-oxo-6,7-dihydro-5H-chromen-3-yl]benzamide |
| SMILES | O=C(Nc1cc2c(oc1=O)/C(=N/Nc1ccc([N+](=O)[O-])cc1)CCC2)c1ccccc1 |
| InChI | InChI=1S/C22H18N4O5/c27-21(14-5-2-1-3-6-14)23-19-13-15-7-4-8-18(20(15)31-22(19)28)25-24-16-9-11-17(12-10-16)26(29)30/h1-3,5-6,9-13,24H,4,7-8H2,(H,23,27)/b25-18+ |
| InChIKey | MARVYPXRNKTSTQ-XIEYBQDHSA-N |
| XLogP | 3.95 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|