C24H31N3O2 — CID 18835267
azepan-1-yl-[(4Z)-3,6,6-trimethyl-4-(phenylhydrazinylidene)-5,7-dihydro-1-benzofuran-2-yl]methanone (PubChem CID 18835267) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is azepan-1-yl-[(4Z)-3,6,6-trimethyl-4-(phenylhydrazinylidene)-5,7-dihydro-1-benzofuran-2-yl]methanone.
| Compound Name | azepan-1-yl-[(4Z)-3,6,6-trimethyl-4-(phenylhydrazinylidene)-5,7-dihydro-1-benzofuran-2-yl]methanone |
|---|---|
| PubChem CID | 18835267 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | azepan-1-yl-[(4Z)-3,6,6-trimethyl-4-(phenylhydrazinylidene)-5,7-dihydro-1-benzofuran-2-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCCCCC2)oc2c1/C(=N\Nc1ccccc1)CC(C)(C)C2 |
| InChI | InChI=1S/C24H31N3O2/c1-17-21-19(26-25-18-11-7-6-8-12-18)15-24(2,3)16-20(21)29-22(17)23(28)27-13-9-4-5-10-14-27/h6-8,11-12,25H,4-5,9-10,13-16H2,1-3H3/b26-19- |
| InChIKey | NDIVQNUKKACHKC-XHPQRKPJSA-N |
| XLogP | 5.39 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|