C26H27N3O3 — CID 18835310
(4Z)-N-(4-acetylphenyl)-3,6,6-trimethyl-4-(phenylhydrazinylidene)-5,7-dihydro-1-benzofuran-2-carboxamide (PubChem CID 18835310) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is (4Z)-N-(4-acetylphenyl)-3,6,6-trimethyl-4-(phenylhydrazinylidene)-5,7-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (4Z)-N-(4-acetylphenyl)-3,6,6-trimethyl-4-(phenylhydrazinylidene)-5,7-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 18835310 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (4Z)-N-(4-acetylphenyl)-3,6,6-trimethyl-4-(phenylhydrazinylidene)-5,7-dihydro-1-benzofuran-2-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2oc3c(c2C)/C(=N\Nc2ccccc2)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C26H27N3O3/c1-16-23-21(29-28-20-8-6-5-7-9-20)14-26(3,4)15-22(23)32-24(16)25(31)27-19-12-10-18(11-13-19)17(2)30/h5-13,28H,14-15H2,1-4H3,(H,27,31)/b29-21- |
| InChIKey | SXIZDBAEFUDYQQ-ANYBSYGZSA-N |
| XLogP | 5.83 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|