C25H25ClN4O3 — CID 18835326
(4Z)-N'-(3-chlorobenzoyl)-3,6,6-trimethyl-4-(phenylhydrazinylidene)-5,7-dihydro-1-benzofuran-2-carbohydrazide (PubChem CID 18835326) has the molecular formula C25H25ClN4O3 and a molecular weight of 464.95 g/mol. Its IUPAC name is (4Z)-N'-(3-chlorobenzoyl)-3,6,6-trimethyl-4-(phenylhydrazinylidene)-5,7-dihydro-1-benzofuran-2-carbohydrazide.
| Compound Name | (4Z)-N'-(3-chlorobenzoyl)-3,6,6-trimethyl-4-(phenylhydrazinylidene)-5,7-dihydro-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 18835326 |
| Molecular Formula | C25H25ClN4O3 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | (4Z)-N'-(3-chlorobenzoyl)-3,6,6-trimethyl-4-(phenylhydrazinylidene)-5,7-dihydro-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2cccc(Cl)c2)oc2c1/C(=N\Nc1ccccc1)CC(C)(C)C2 |
| InChI | InChI=1S/C25H25ClN4O3/c1-15-21-19(28-27-18-10-5-4-6-11-18)13-25(2,3)14-20(21)33-22(15)24(32)30-29-23(31)16-8-7-9-17(26)12-16/h4-12,27H,13-14H2,1-3H3,(H,29,31)(H,30,32)/b28-19- |
| InChIKey | DLFAXOFSNUAJTK-USHMODERSA-N |
| XLogP | 5.10 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|