C20H22ClN5O4 — CID 18835817
[(Z)-[2-[[(4-chlorobenzoyl)amino]carbamoyl]-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-4-ylidene]amino]urea (PubChem CID 18835817) has the molecular formula C20H22ClN5O4 and a molecular weight of 431.88 g/mol. Its IUPAC name is [(Z)-[2-[[(4-chlorobenzoyl)amino]carbamoyl]-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-4-ylidene]amino]urea.
| Compound Name | [(Z)-[2-[[(4-chlorobenzoyl)amino]carbamoyl]-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-4-ylidene]amino]urea |
|---|---|
| PubChem CID | 18835817 |
| Molecular Formula | C20H22ClN5O4 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | [(Z)-[2-[[(4-chlorobenzoyl)amino]carbamoyl]-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-4-ylidene]amino]urea |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc(Cl)cc2)oc2c1/C(=N\NC(N)=O)CC(C)(C)C2 |
| InChI | InChI=1S/C20H22ClN5O4/c1-10-15-13(23-26-19(22)29)8-20(2,3)9-14(15)30-16(10)18(28)25-24-17(27)11-4-6-12(21)7-5-11/h4-7H,8-9H2,1-3H3,(H,24,27)(H,25,28)(H3,22,26,29)/b23-13- |
| InChIKey | BFHUAQZTFMJTSZ-QRVIBDJDSA-N |
| XLogP | 2.66 |
| TPSA | 138.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|