C19H19ClN2O4 — CID 18832045
N'-(4-chlorobenzoyl)-3,6,6-trimethyl-4-oxo-5,7-dihydro-1-benzofuran-2-carbohydrazide (PubChem CID 18832045) has the molecular formula C19H19ClN2O4 and a molecular weight of 374.82 g/mol. Its IUPAC name is N'-(4-chlorobenzoyl)-3,6,6-trimethyl-4-oxo-5,7-dihydro-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-(4-chlorobenzoyl)-3,6,6-trimethyl-4-oxo-5,7-dihydro-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 18832045 |
| Molecular Formula | C19H19ClN2O4 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | N'-(4-chlorobenzoyl)-3,6,6-trimethyl-4-oxo-5,7-dihydro-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc(Cl)cc2)oc2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C19H19ClN2O4/c1-10-15-13(23)8-19(2,3)9-14(15)26-16(10)18(25)22-21-17(24)11-4-6-12(20)7-5-11/h4-7H,8-9H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | NUDQQORTHPRZQE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|