C21H24N2O5 — CID 86832430
N'-[2-(2-methoxyphenyl)acetyl]-3,6,6-trimethyl-4-oxo-5,7-dihydro-1-benzofuran-2-carbohydrazide (PubChem CID 86832430) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is N'-[2-(2-methoxyphenyl)acetyl]-3,6,6-trimethyl-4-oxo-5,7-dihydro-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-[2-(2-methoxyphenyl)acetyl]-3,6,6-trimethyl-4-oxo-5,7-dihydro-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 86832430 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N'-[2-(2-methoxyphenyl)acetyl]-3,6,6-trimethyl-4-oxo-5,7-dihydro-1-benzofuran-2-carbohydrazide |
| SMILES | COc1ccccc1CC(=O)NNC(=O)c1oc2c(c1C)C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C21H24N2O5/c1-12-18-14(24)10-21(2,3)11-16(18)28-19(12)20(26)23-22-17(25)9-13-7-5-6-8-15(13)27-4/h5-8H,9-11H2,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | ZMMNUSKOUTUYDK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|