C20H22N6O6 — CID 18835820
[(Z)-[3,6,6-trimethyl-2-[[(2-nitrobenzoyl)amino]carbamoyl]-5,7-dihydro-1-benzofuran-4-ylidene]amino]urea (PubChem CID 18835820) has the molecular formula C20H22N6O6 and a molecular weight of 442.43 g/mol. Its IUPAC name is [(Z)-[3,6,6-trimethyl-2-[[(2-nitrobenzoyl)amino]carbamoyl]-5,7-dihydro-1-benzofuran-4-ylidene]amino]urea.
| Compound Name | [(Z)-[3,6,6-trimethyl-2-[[(2-nitrobenzoyl)amino]carbamoyl]-5,7-dihydro-1-benzofuran-4-ylidene]amino]urea |
|---|---|
| PubChem CID | 18835820 |
| Molecular Formula | C20H22N6O6 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [(Z)-[3,6,6-trimethyl-2-[[(2-nitrobenzoyl)amino]carbamoyl]-5,7-dihydro-1-benzofuran-4-ylidene]amino]urea |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccccc2[N+](=O)[O-])oc2c1/C(=N\NC(N)=O)CC(C)(C)C2 |
| InChI | InChI=1S/C20H22N6O6/c1-10-15-12(22-25-19(21)29)8-20(2,3)9-14(15)32-16(10)18(28)24-23-17(27)11-6-4-5-7-13(11)26(30)31/h4-7H,8-9H2,1-3H3,(H,23,27)(H,24,28)(H3,21,25,29)/b22-12- |
| InChIKey | HVLAJVHLRJBVDZ-UUYOSTAYSA-N |
| XLogP | 1.92 |
| TPSA | 181.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|