C20H23N7O5 — CID 18835487
2-[(Z)-[3,6,6-trimethyl-2-[[(2-nitrobenzoyl)amino]carbamoyl]-5,7-dihydro-1-benzofuran-4-ylidene]amino]guanidine (PubChem CID 18835487) has the molecular formula C20H23N7O5 and a molecular weight of 441.45 g/mol. Its IUPAC name is 2-[(Z)-[3,6,6-trimethyl-2-[[(2-nitrobenzoyl)amino]carbamoyl]-5,7-dihydro-1-benzofuran-4-ylidene]amino]guanidine.
| Compound Name | 2-[(Z)-[3,6,6-trimethyl-2-[[(2-nitrobenzoyl)amino]carbamoyl]-5,7-dihydro-1-benzofuran-4-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 18835487 |
| Molecular Formula | C20H23N7O5 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2-[(Z)-[3,6,6-trimethyl-2-[[(2-nitrobenzoyl)amino]carbamoyl]-5,7-dihydro-1-benzofuran-4-ylidene]amino]guanidine |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccccc2[N+](=O)[O-])oc2c1/C(=N\N=C(N)N)CC(C)(C)C2 |
| InChI | InChI=1S/C20H23N7O5/c1-10-15-12(23-26-19(21)22)8-20(2,3)9-14(15)32-16(10)18(29)25-24-17(28)11-6-4-5-7-13(11)27(30)31/h4-7H,8-9H2,1-3H3,(H,24,28)(H,25,29)(H4,21,22,26)/b23-12- |
| InChIKey | DLXKSBRDVVKYRG-FMCGGJTJSA-N |
| XLogP | 1.52 |
| TPSA | 191.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|