C28H27N3O3 — CID 18835343
(2-methylquinolin-8-yl) (4Z)-3,6,6-trimethyl-4-(phenylhydrazinylidene)-5,7-dihydro-1-benzofuran-2-carboxylate (PubChem CID 18835343) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is (2-methylquinolin-8-yl) (4Z)-3,6,6-trimethyl-4-(phenylhydrazinylidene)-5,7-dihydro-1-benzofuran-2-carboxylate.
| Compound Name | (2-methylquinolin-8-yl) (4Z)-3,6,6-trimethyl-4-(phenylhydrazinylidene)-5,7-dihydro-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 18835343 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | (2-methylquinolin-8-yl) (4Z)-3,6,6-trimethyl-4-(phenylhydrazinylidene)-5,7-dihydro-1-benzofuran-2-carboxylate |
| SMILES | Cc1ccc2cccc(OC(=O)c3oc4c(c3C)/C(=N\Nc3ccccc3)CC(C)(C)C4)c2n1 |
| InChI | InChI=1S/C28H27N3O3/c1-17-13-14-19-9-8-12-22(25(19)29-17)34-27(32)26-18(2)24-21(15-28(3,4)16-23(24)33-26)31-30-20-10-6-5-7-11-20/h5-14,30H,15-16H2,1-4H3/b31-21- |
| InChIKey | VCPJRXKSVOGLTN-YQYKVWLJSA-N |
| XLogP | 6.45 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|