C19H28N4O3 — CID 18835701
[(Z)-[3,6,6-trimethyl-2-(4-methylpiperidine-1-carbonyl)-5,7-dihydro-1-benzofuran-4-ylidene]amino]urea (PubChem CID 18835701) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is [(Z)-[3,6,6-trimethyl-2-(4-methylpiperidine-1-carbonyl)-5,7-dihydro-1-benzofuran-4-ylidene]amino]urea.
| Compound Name | [(Z)-[3,6,6-trimethyl-2-(4-methylpiperidine-1-carbonyl)-5,7-dihydro-1-benzofuran-4-ylidene]amino]urea |
|---|---|
| PubChem CID | 18835701 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | [(Z)-[3,6,6-trimethyl-2-(4-methylpiperidine-1-carbonyl)-5,7-dihydro-1-benzofuran-4-ylidene]amino]urea |
| SMILES | Cc1c(C(=O)N2CCC(C)CC2)oc2c1/C(=N\NC(N)=O)CC(C)(C)C2 |
| InChI | InChI=1S/C19H28N4O3/c1-11-5-7-23(8-6-11)17(24)16-12(2)15-13(21-22-18(20)25)9-19(3,4)10-14(15)26-16/h11H,5-10H2,1-4H3,(H3,20,22,25)/b21-13- |
| InChIKey | DRCRLBFYRWMSNF-BKUYFWCQSA-N |
| XLogP | 2.80 |
| TPSA | 100.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|