C18H27N5O2S — CID 18835603
[(Z)-[3,6,6-trimethyl-2-(4-methylpiperazine-1-carbonyl)-5,7-dihydro-1-benzofuran-4-ylidene]amino]thiourea (PubChem CID 18835603) has the molecular formula C18H27N5O2S and a molecular weight of 377.51 g/mol. Its IUPAC name is [(Z)-[3,6,6-trimethyl-2-(4-methylpiperazine-1-carbonyl)-5,7-dihydro-1-benzofuran-4-ylidene]amino]thiourea.
| Compound Name | [(Z)-[3,6,6-trimethyl-2-(4-methylpiperazine-1-carbonyl)-5,7-dihydro-1-benzofuran-4-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 18835603 |
| Molecular Formula | C18H27N5O2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | [(Z)-[3,6,6-trimethyl-2-(4-methylpiperazine-1-carbonyl)-5,7-dihydro-1-benzofuran-4-ylidene]amino]thiourea |
| SMILES | Cc1c(C(=O)N2CCN(C)CC2)oc2c1/C(=N\NC(N)=S)CC(C)(C)C2 |
| InChI | InChI=1S/C18H27N5O2S/c1-11-14-12(20-21-17(19)26)9-18(2,3)10-13(14)25-15(11)16(24)23-7-5-22(4)6-8-23/h5-10H2,1-4H3,(H3,19,21,26)/b20-12- |
| InChIKey | IZUDMMQBZCIKLP-NDENLUEZSA-N |
| XLogP | 1.49 |
| TPSA | 87.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_J(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|