C21H26N4O2S — CID 18835574
(4Z)-4-(carbamothioylhydrazinylidene)-N-(4-ethylphenyl)-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxamide (PubChem CID 18835574) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is (4Z)-4-(carbamothioylhydrazinylidene)-N-(4-ethylphenyl)-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (4Z)-4-(carbamothioylhydrazinylidene)-N-(4-ethylphenyl)-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 18835574 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | (4Z)-4-(carbamothioylhydrazinylidene)-N-(4-ethylphenyl)-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2oc3c(c2C)/C(=N\NC(N)=S)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C21H26N4O2S/c1-5-13-6-8-14(9-7-13)23-19(26)18-12(2)17-15(24-25-20(22)28)10-21(3,4)11-16(17)27-18/h6-9H,5,10-11H2,1-4H3,(H,23,26)(H3,22,25,28)/b24-15- |
| InChIKey | ICZJNXMAAUWBJP-IWIPYMOSSA-N |
| XLogP | 3.91 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_J(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|