C23H25N5O2S — CID 18835547
(4Z)-4-(carbamothioylhydrazinylidene)-3,6,6-trimethyl-N-(2-methylquinolin-4-yl)-5,7-dihydro-1-benzofuran-2-carboxamide (PubChem CID 18835547) has the molecular formula C23H25N5O2S and a molecular weight of 435.55 g/mol. Its IUPAC name is (4Z)-4-(carbamothioylhydrazinylidene)-3,6,6-trimethyl-N-(2-methylquinolin-4-yl)-5,7-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (4Z)-4-(carbamothioylhydrazinylidene)-3,6,6-trimethyl-N-(2-methylquinolin-4-yl)-5,7-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 18835547 |
| Molecular Formula | C23H25N5O2S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | (4Z)-4-(carbamothioylhydrazinylidene)-3,6,6-trimethyl-N-(2-methylquinolin-4-yl)-5,7-dihydro-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2oc3c(c2C)/C(=N\NC(N)=S)CC(C)(C)C3)c2ccccc2n1 |
| InChI | InChI=1S/C23H25N5O2S/c1-12-9-16(14-7-5-6-8-15(14)25-12)26-21(29)20-13(2)19-17(27-28-22(24)31)10-23(3,4)11-18(19)30-20/h5-9H,10-11H2,1-4H3,(H3,24,28,31)(H,25,26,29)/b27-17- |
| InChIKey | FCLVVLCDLOYGBT-PKAZHMFMSA-N |
| XLogP | 4.21 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_J(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|