C25H28N4O2S — CID 18835673
(4Z)-4-(carbamothioylhydrazinylidene)-N-ethyl-3,6,6-trimethyl-N-naphthalen-1-yl-5,7-dihydro-1-benzofuran-2-carboxamide (PubChem CID 18835673) has the molecular formula C25H28N4O2S and a molecular weight of 448.59 g/mol. Its IUPAC name is (4Z)-4-(carbamothioylhydrazinylidene)-N-ethyl-3,6,6-trimethyl-N-naphthalen-1-yl-5,7-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (4Z)-4-(carbamothioylhydrazinylidene)-N-ethyl-3,6,6-trimethyl-N-naphthalen-1-yl-5,7-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 18835673 |
| Molecular Formula | C25H28N4O2S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | (4Z)-4-(carbamothioylhydrazinylidene)-N-ethyl-3,6,6-trimethyl-N-naphthalen-1-yl-5,7-dihydro-1-benzofuran-2-carboxamide |
| SMILES | CCN(C(=O)c1oc2c(c1C)/C(=N\NC(N)=S)CC(C)(C)C2)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H28N4O2S/c1-5-29(19-12-8-10-16-9-6-7-11-17(16)19)23(30)22-15(2)21-18(27-28-24(26)32)13-25(3,4)14-20(21)31-22/h6-12H,5,13-14H2,1-4H3,(H3,26,28,32)/b27-18- |
| InChIKey | IHLJAJVOJSIETL-IMRQLAEWSA-N |
| XLogP | 4.92 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_J(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|