C27H27N5 — CID 146170717
6,6-dimethyl-N,2-diphenyl-4-(phenylhydrazinylidene)-5,7-dihydroindazol-3-amine (PubChem CID 146170717) has the molecular formula C27H27N5 and a molecular weight of 421.55 g/mol. Its IUPAC name is 6,6-dimethyl-N,2-diphenyl-4-(phenylhydrazinylidene)-5,7-dihydroindazol-3-amine.
| Compound Name | 6,6-dimethyl-N,2-diphenyl-4-(phenylhydrazinylidene)-5,7-dihydroindazol-3-amine |
|---|---|
| PubChem CID | 146170717 |
| Molecular Formula | C27H27N5 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 6,6-dimethyl-N,2-diphenyl-4-(phenylhydrazinylidene)-5,7-dihydroindazol-3-amine |
| SMILES | CC1(C)CC(=NNc2ccccc2)c2c(nn(-c3ccccc3)c2Nc2ccccc2)C1 |
| InChI | InChI=1S/C27H27N5/c1-27(2)18-23(30-29-21-14-8-4-9-15-21)25-24(19-27)31-32(22-16-10-5-11-17-22)26(25)28-20-12-6-3-7-13-20/h3-17,28-29H,18-19H2,1-2H3 |
| InChIKey | ZEBDPVXNDVPEDR-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|