C23H22ClN3O2 — CID 18833296
[(E)-(3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-ylidene)amino] 3-chlorobenzoate (PubChem CID 18833296) has the molecular formula C23H22ClN3O2 and a molecular weight of 407.90 g/mol. Its IUPAC name is [(E)-(3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-ylidene)amino] 3-chlorobenzoate.
| Compound Name | [(E)-(3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-ylidene)amino] 3-chlorobenzoate |
|---|---|
| PubChem CID | 18833296 |
| Molecular Formula | C23H22ClN3O2 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | [(E)-(3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-ylidene)amino] 3-chlorobenzoate |
| SMILES | Cc1nn(-c2ccccc2)c2c1/C(=N/OC(=O)c1cccc(Cl)c1)CC(C)(C)C2 |
| InChI | InChI=1S/C23H22ClN3O2/c1-15-21-19(26-29-22(28)16-8-7-9-17(24)12-16)13-23(2,3)14-20(21)27(25-15)18-10-5-4-6-11-18/h4-12H,13-14H2,1-3H3/b26-19+ |
| InChIKey | NOXOKVVRPQATMG-LGUFXXKBSA-N |
| XLogP | 5.37 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|