C24H25N3O3 — CID 18833305
[(E)-(3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-ylidene)amino] 2-methoxybenzoate (PubChem CID 18833305) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is [(E)-(3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-ylidene)amino] 2-methoxybenzoate.
| Compound Name | [(E)-(3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-ylidene)amino] 2-methoxybenzoate |
|---|---|
| PubChem CID | 18833305 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | [(E)-(3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-ylidene)amino] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)O/N=C1\CC(C)(C)Cc2c1c(C)nn2-c1ccccc1 |
| InChI | InChI=1S/C24H25N3O3/c1-16-22-19(26-30-23(28)18-12-8-9-13-21(18)29-4)14-24(2,3)15-20(22)27(25-16)17-10-6-5-7-11-17/h5-13H,14-15H2,1-4H3/b26-19+ |
| InChIKey | CMSBSLAJYQXQSF-LGUFXXKBSA-N |
| XLogP | 4.72 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|