C23H21Cl2N3O2 — CID 18833306
[(E)-(3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-ylidene)amino] 2,4-dichlorobenzoate (PubChem CID 18833306) has the molecular formula C23H21Cl2N3O2 and a molecular weight of 442.35 g/mol. Its IUPAC name is [(E)-(3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-ylidene)amino] 2,4-dichlorobenzoate.
| Compound Name | [(E)-(3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-ylidene)amino] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 18833306 |
| Molecular Formula | C23H21Cl2N3O2 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | [(E)-(3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-ylidene)amino] 2,4-dichlorobenzoate |
| SMILES | Cc1nn(-c2ccccc2)c2c1/C(=N/OC(=O)c1ccc(Cl)cc1Cl)CC(C)(C)C2 |
| InChI | InChI=1S/C23H21Cl2N3O2/c1-14-21-19(27-30-22(29)17-10-9-15(24)11-18(17)25)12-23(2,3)13-20(21)28(26-14)16-7-5-4-6-8-16/h4-11H,12-13H2,1-3H3/b27-19+ |
| InChIKey | FXSVKZJNUKXFJO-ZXVVBBHZSA-N |
| XLogP | 6.02 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|