C18H20N2O5 — CID 90734579
2-imino-4-(2-methoxyphenyl)-7,7-dimethyl-3-nitro-3,4,6,8-tetrahydrochromen-5-one (PubChem CID 90734579) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-imino-4-(2-methoxyphenyl)-7,7-dimethyl-3-nitro-3,4,6,8-tetrahydrochromen-5-one.
| Compound Name | 2-imino-4-(2-methoxyphenyl)-7,7-dimethyl-3-nitro-3,4,6,8-tetrahydrochromen-5-one |
|---|---|
| PubChem CID | 90734579 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-imino-4-(2-methoxyphenyl)-7,7-dimethyl-3-nitro-3,4,6,8-tetrahydrochromen-5-one |
| SMILES | [H]/N=C1\OC2=C(C(=O)CC(C)(C)C2)C(c2ccccc2OC)C1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N2O5/c1-18(2)8-11(21)15-13(9-18)25-17(19)16(20(22)23)14(15)10-6-4-5-7-12(10)24-3/h4-7,14,16,19H,8-9H2,1-3H3/b19-17- |
| InChIKey | CWLYDGUEGFJLFS-ZPHPHTNESA-N |
| XLogP | 3.07 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|