C20H18N2O2 — CID 91897977
2-imino-7,7-dimethyl-5-oxo-4-(2-phenylethynyl)-3,4,6,8-tetrahydrochromene-3-carbonitrile (PubChem CID 91897977) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-imino-7,7-dimethyl-5-oxo-4-(2-phenylethynyl)-3,4,6,8-tetrahydrochromene-3-carbonitrile.
| Compound Name | 2-imino-7,7-dimethyl-5-oxo-4-(2-phenylethynyl)-3,4,6,8-tetrahydrochromene-3-carbonitrile |
|---|---|
| PubChem CID | 91897977 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-imino-7,7-dimethyl-5-oxo-4-(2-phenylethynyl)-3,4,6,8-tetrahydrochromene-3-carbonitrile |
| SMILES | [H]/N=C1\OC2=C(C(=O)CC(C)(C)C2)C(C#Cc2ccccc2)C1C#N |
| InChI | InChI=1S/C20H18N2O2/c1-20(2)10-16(23)18-14(9-8-13-6-4-3-5-7-13)15(12-21)19(22)24-17(18)11-20/h3-7,14-15,22H,10-11H2,1-2H3/b22-19- |
| InChIKey | OGWSXENZOIBOGG-QOCHGBHMSA-N |
| XLogP | 3.44 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|