C23H21N3O2 — CID 91929774
(4S)-2-imino-5-oxo-4-phenyl-7-[(1R)-1-phenylethyl]-3,4,6,8-tetrahydropyrano[2,3-c]pyridine-3-carbonitrile (PubChem CID 91929774) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is (4S)-2-imino-5-oxo-4-phenyl-7-[(1R)-1-phenylethyl]-3,4,6,8-tetrahydropyrano[2,3-c]pyridine-3-carbonitrile.
| Compound Name | (4S)-2-imino-5-oxo-4-phenyl-7-[(1R)-1-phenylethyl]-3,4,6,8-tetrahydropyrano[2,3-c]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 91929774 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | (4S)-2-imino-5-oxo-4-phenyl-7-[(1R)-1-phenylethyl]-3,4,6,8-tetrahydropyrano[2,3-c]pyridine-3-carbonitrile |
| SMILES | [H]/N=C1\OC2=C(C(=O)CN([C@H](C)c3ccccc3)C2)[C@H](c2ccccc2)C1C#N |
| InChI | InChI=1S/C23H21N3O2/c1-15(16-8-4-2-5-9-16)26-13-19(27)22-20(14-26)28-23(25)18(12-24)21(22)17-10-6-3-7-11-17/h2-11,15,18,21,25H,13-14H2,1H3/b25-23-/t15-,18?,21-/m1/s1 |
| InChIKey | QBBREKCMHWZDRU-XBMNJZAASA-N |
| XLogP | 3.82 |
| TPSA | 77.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|