C14H11ClN2OS — CID 91594197
7-(3-chlorophenyl)-5-imino-2,3,6,7-tetrahydrothieno[3,2-b]pyran-6-carbonitrile (PubChem CID 91594197) has the molecular formula C14H11ClN2OS and a molecular weight of 290.77 g/mol. Its IUPAC name is 7-(3-chlorophenyl)-5-imino-2,3,6,7-tetrahydrothieno[3,2-b]pyran-6-carbonitrile.
| Compound Name | 7-(3-chlorophenyl)-5-imino-2,3,6,7-tetrahydrothieno[3,2-b]pyran-6-carbonitrile |
|---|---|
| PubChem CID | 91594197 |
| Molecular Formula | C14H11ClN2OS |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 7-(3-chlorophenyl)-5-imino-2,3,6,7-tetrahydrothieno[3,2-b]pyran-6-carbonitrile |
| SMILES | [H]/N=C1\OC2=C(SCC2)C(c2cccc(Cl)c2)C1C#N |
| InChI | InChI=1S/C14H11ClN2OS/c15-9-3-1-2-8(6-9)12-10(7-16)14(17)18-11-4-5-19-13(11)12/h1-3,6,10,12,17H,4-5H2/b17-14- |
| InChIKey | RIBCIHRYPQSONU-VKAVYKQESA-N |
| XLogP | 3.92 |
| TPSA | 56.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|