C20H14ClN3O — CID 11244960
7-amino-4-(4-chlorophenyl)-2-imino-3,4-dihydrobenzo[h]chromene-3-carbonitrile (PubChem CID 11244960) has the molecular formula C20H14ClN3O and a molecular weight of 347.81 g/mol. Its IUPAC name is 7-amino-4-(4-chlorophenyl)-2-imino-3,4-dihydrobenzo[h]chromene-3-carbonitrile.
| Compound Name | 7-amino-4-(4-chlorophenyl)-2-imino-3,4-dihydrobenzo[h]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 11244960 |
| Molecular Formula | C20H14ClN3O |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 7-amino-4-(4-chlorophenyl)-2-imino-3,4-dihydrobenzo[h]chromene-3-carbonitrile |
| SMILES | [H]/N=C1\Oc2c(ccc3c(N)cccc23)C(c2ccc(Cl)cc2)C1C#N |
| InChI | InChI=1S/C20H14ClN3O/c21-12-6-4-11(5-7-12)18-15-9-8-13-14(2-1-3-17(13)23)19(15)25-20(24)16(18)10-22/h1-9,16,18,24H,23H2/b24-20- |
| InChIKey | HMGMUENLFWVGFC-GFMRDNFCSA-N |
| XLogP | 4.72 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|