C18H14BrClN2O3 — CID 91092291
4-(3-bromo-4,5-dimethoxyphenyl)-7-chloro-2-imino-3,4-dihydrochromene-3-carbonitrile (PubChem CID 91092291) has the molecular formula C18H14BrClN2O3 and a molecular weight of 421.68 g/mol. Its IUPAC name is 4-(3-bromo-4,5-dimethoxyphenyl)-7-chloro-2-imino-3,4-dihydrochromene-3-carbonitrile.
| Compound Name | 4-(3-bromo-4,5-dimethoxyphenyl)-7-chloro-2-imino-3,4-dihydrochromene-3-carbonitrile |
|---|---|
| PubChem CID | 91092291 |
| Molecular Formula | C18H14BrClN2O3 |
| Molecular Weight | 421.68 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | 4-(3-bromo-4,5-dimethoxyphenyl)-7-chloro-2-imino-3,4-dihydrochromene-3-carbonitrile |
| SMILES | [H]/N=C1\Oc2cc(Cl)ccc2C(c2cc(Br)c(OC)c(OC)c2)C1C#N |
| InChI | InChI=1S/C18H14BrClN2O3/c1-23-15-6-9(5-13(19)17(15)24-2)16-11-4-3-10(20)7-14(11)25-18(22)12(16)8-21/h3-7,12,16,22H,1-2H3/b22-18- |
| InChIKey | GAEVYNRJPYDETQ-PYCFMQQDSA-N |
| XLogP | 4.76 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.68 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|