C20H20BrN3O3 — CID 91436368
4-(3-bromo-4,5-dimethoxyphenyl)-7-(ethylamino)-2-imino-3,4-dihydrochromene-3-carbonitrile (PubChem CID 91436368) has the molecular formula C20H20BrN3O3 and a molecular weight of 430.30 g/mol. Its IUPAC name is 4-(3-bromo-4,5-dimethoxyphenyl)-7-(ethylamino)-2-imino-3,4-dihydrochromene-3-carbonitrile.
| Compound Name | 4-(3-bromo-4,5-dimethoxyphenyl)-7-(ethylamino)-2-imino-3,4-dihydrochromene-3-carbonitrile |
|---|---|
| PubChem CID | 91436368 |
| Molecular Formula | C20H20BrN3O3 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 4-(3-bromo-4,5-dimethoxyphenyl)-7-(ethylamino)-2-imino-3,4-dihydrochromene-3-carbonitrile |
| SMILES | [H]/N=C1\Oc2cc(NCC)ccc2C(c2cc(Br)c(OC)c(OC)c2)C1C#N |
| InChI | InChI=1S/C20H20BrN3O3/c1-4-24-12-5-6-13-16(9-12)27-20(23)14(10-22)18(13)11-7-15(21)19(26-3)17(8-11)25-2/h5-9,14,18,23-24H,4H2,1-3H3/b23-20- |
| InChIKey | NMLRQJOKKQEUAZ-ATJXCDBQSA-N |
| XLogP | 4.54 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|