C22H19BrN4O3 — CID 123396295
4-(3-bromo-4,5-dimethoxyphenyl)-2-imino-9-(methylamino)-3,4-dihydropyrano[3,2-h]quinoline-3-carbonitrile (PubChem CID 123396295) has the molecular formula C22H19BrN4O3 and a molecular weight of 467.32 g/mol. Its IUPAC name is 4-(3-bromo-4,5-dimethoxyphenyl)-2-imino-9-(methylamino)-3,4-dihydropyrano[3,2-h]quinoline-3-carbonitrile.
| Compound Name | 4-(3-bromo-4,5-dimethoxyphenyl)-2-imino-9-(methylamino)-3,4-dihydropyrano[3,2-h]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 123396295 |
| Molecular Formula | C22H19BrN4O3 |
| Molecular Weight | 467.32 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | 4-(3-bromo-4,5-dimethoxyphenyl)-2-imino-9-(methylamino)-3,4-dihydropyrano[3,2-h]quinoline-3-carbonitrile |
| SMILES | [H]/N=C1\Oc2c(ccc3ccc(NC)nc23)C(c2cc(Br)c(OC)c(OC)c2)C1C#N |
| InChI | InChI=1S/C22H19BrN4O3/c1-26-17-7-5-11-4-6-13-18(12-8-15(23)21(29-3)16(9-12)28-2)14(10-24)22(25)30-20(13)19(11)27-17/h4-9,14,18,25H,1-3H3,(H,26,27)/b25-22- |
| InChIKey | PVNLJCAJTKWNLA-LVWGJNHUSA-N |
| XLogP | 4.70 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.32 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|