C21H20BrN3O3 — CID 91313764
4-(3-bromo-4,5-dimethoxyphenyl)-2-imino-7-methyl-3,4,8,9-tetrahydropyrano[2,3-e]indole-3-carbonitrile (PubChem CID 91313764) has the molecular formula C21H20BrN3O3 and a molecular weight of 442.31 g/mol. Its IUPAC name is 4-(3-bromo-4,5-dimethoxyphenyl)-2-imino-7-methyl-3,4,8,9-tetrahydropyrano[2,3-e]indole-3-carbonitrile.
| Compound Name | 4-(3-bromo-4,5-dimethoxyphenyl)-2-imino-7-methyl-3,4,8,9-tetrahydropyrano[2,3-e]indole-3-carbonitrile |
|---|---|
| PubChem CID | 91313764 |
| Molecular Formula | C21H20BrN3O3 |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 4-(3-bromo-4,5-dimethoxyphenyl)-2-imino-7-methyl-3,4,8,9-tetrahydropyrano[2,3-e]indole-3-carbonitrile |
| SMILES | [H]/N=C1\Oc2c(ccc3c2CCN3C)C(c2cc(Br)c(OC)c(OC)c2)C1C#N |
| InChI | InChI=1S/C21H20BrN3O3/c1-25-7-6-12-16(25)5-4-13-18(14(10-23)21(24)28-19(12)13)11-8-15(22)20(27-3)17(9-11)26-2/h4-5,8-9,14,18,24H,6-7H2,1-3H3/b24-21- |
| InChIKey | RPQSYQPOLNKVFZ-FLFQWRMESA-N |
| XLogP | 4.10 |
| TPSA | 78.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|