C20H20BrN5O4 — CID 91288235
2-amino-N-[8-amino-4-(3-bromo-4,5-dimethoxyphenyl)-3-cyano-2-imino-3,4-dihydrochromen-7-yl]acetamide (PubChem CID 91288235) has the molecular formula C20H20BrN5O4 and a molecular weight of 474.32 g/mol. Its IUPAC name is 2-amino-N-[8-amino-4-(3-bromo-4,5-dimethoxyphenyl)-3-cyano-2-imino-3,4-dihydrochromen-7-yl]acetamide.
| Compound Name | 2-amino-N-[8-amino-4-(3-bromo-4,5-dimethoxyphenyl)-3-cyano-2-imino-3,4-dihydrochromen-7-yl]acetamide |
|---|---|
| PubChem CID | 91288235 |
| Molecular Formula | C20H20BrN5O4 |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 2-amino-N-[8-amino-4-(3-bromo-4,5-dimethoxyphenyl)-3-cyano-2-imino-3,4-dihydrochromen-7-yl]acetamide |
| SMILES | [H]/N=C1\Oc2c(ccc(NC(=O)CN)c2N)C(c2cc(Br)c(OC)c(OC)c2)C1C#N |
| InChI | InChI=1S/C20H20BrN5O4/c1-28-14-6-9(5-12(21)19(14)29-2)16-10-3-4-13(26-15(27)8-23)17(24)18(10)30-20(25)11(16)7-22/h3-6,11,16,25H,8,23-24H2,1-2H3,(H,26,27)/b25-20- |
| InChIKey | RUPCNRNUJWJXTB-QQTULTPQSA-N |
| XLogP | 2.59 |
| TPSA | 156.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|