About 4-(3-bromo-4,5-dimethoxyphenyl)-9-methyl-4H-pyrano[3,2-h]quinolin-2-amine
4-(3-bromo-4,5-dimethoxyphenyl)-9-methyl-4H-pyrano[3,2-h]quinolin-2-amine (PubChem CID 141338014) has the molecular formula C21H19BrN2O3
and a molecular weight of 427.30 g/mol. Its IUPAC name is 4-(3-bromo-4,5-dimethoxyphenyl)-9-methyl-4H-pyrano[3,2-h]quinolin-2-amine.
Molecular Properties
| Compound Name | 4-(3-bromo-4,5-dimethoxyphenyl)-9-methyl-4H-pyrano[3,2-h]quinolin-2-amine |
| PubChem CID | 141338014 |
| Molecular Formula | C21H19BrN2O3 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 4-(3-bromo-4,5-dimethoxyphenyl)-9-methyl-4H-pyrano[3,2-h]quinolin-2-amine |
| SMILES | COc1cc(C2C=C(N)Oc3c2ccc2ccc(C)nc32)cc(Br)c1OC |
| InChI | InChI=1S/C21H19BrN2O3/c1-11-4-5-12-6-7-14-15(10-18(23)27-20(14)19(12)24-11)13-8-16(22)21(26-3)17(9-13)25-2/h4-10,15H,23H2,1-3H3 |
| InChIKey | HXPFTVUPNIDPKO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3-bromo-4,5-dimethoxyphenyl)-9-methyl-4H-pyrano[3,2-h]quinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-bromo-4,5-dimethoxyphenyl)-9-methyl-4H-pyrano[3,2-h]quinolin-2-amine?
The IUPAC name of 4-(3-bromo-4,5-dimethoxyphenyl)-9-methyl-4H-pyrano[3,2-h]quinolin-2-amine (CID 141338014) is 4-(3-bromo-4,5-dimethoxyphenyl)-9-methyl-4H-pyrano[3,2-h]quinolin-2-amine.
What is the SMILES notation for 4-(3-bromo-4,5-dimethoxyphenyl)-9-methyl-4H-pyrano[3,2-h]quinolin-2-amine?
The canonical SMILES for 4-(3-bromo-4,5-dimethoxyphenyl)-9-methyl-4H-pyrano[3,2-h]quinolin-2-amine is COc1cc(C2C=C(N)Oc3c2ccc2ccc(C)nc32)cc(Br)c1OC.
What is the InChIKey of 4-(3-bromo-4,5-dimethoxyphenyl)-9-methyl-4H-pyrano[3,2-h]quinolin-2-amine?
The InChIKey is HXPFTVUPNIDPKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19BrN2O3/c1-11-4-5-12-6-7-14-15(10-18(23)27-20(14)19(12)24-11)13-8-16(22)21(26-3)17(9-13)25-2/h4-10,15H,23H2,1-3H3.
What are the key properties of 4-(3-bromo-4,5-dimethoxyphenyl)-9-methyl-4H-pyrano[3,2-h]quinolin-2-amine?
4-(3-bromo-4,5-dimethoxyphenyl)-9-methyl-4H-pyrano[3,2-h]quinolin-2-amine has a molecular weight of 427.30 g/mol, XLogP of 4.65, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromo-4,5-dimethoxyphenyl)-9-methyl-4H-pyrano[3,2-h]quinolin-2-amine is sourced from PubChem (CID 141338014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).