C14H16BrN3O2 — CID 133300412
N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-6-methylpyrimidin-4-amine (PubChem CID 133300412) has the molecular formula C14H16BrN3O2 and a molecular weight of 338.21 g/mol. Its IUPAC name is N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-6-methylpyrimidin-4-amine.
| Compound Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133300412 |
| Molecular Formula | C14H16BrN3O2 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-6-methylpyrimidin-4-amine |
| SMILES | COc1cc(CNc2cc(C)ncn2)cc(Br)c1OC |
| InChI | InChI=1S/C14H16BrN3O2/c1-9-4-13(18-8-17-9)16-7-10-5-11(15)14(20-3)12(6-10)19-2/h4-6,8H,7H2,1-3H3,(H,16,17,18) |
| InChIKey | LLCFEGFPJWONHA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |