C14H11BrF4N2O2 — CID 133371984
N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine (PubChem CID 133371984) has the molecular formula C14H11BrF4N2O2 and a molecular weight of 395.15 g/mol. Its IUPAC name is N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine.
| Compound Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine |
|---|---|
| PubChem CID | 133371984 |
| Molecular Formula | C14H11BrF4N2O2 |
| Molecular Weight | 395.15 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine |
| SMILES | COc1cc(CNc2c(F)c(F)nc(F)c2F)cc(Br)c1OC |
| InChI | InChI=1S/C14H11BrF4N2O2/c1-22-8-4-6(3-7(15)12(8)23-2)5-20-11-9(16)13(18)21-14(19)10(11)17/h3-4H,5H2,1-2H3,(H,20,21) |
| InChIKey | BHSFNLGQVCLJKO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.15 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|