C14H10Br2Cl2FNO — CID 107572617
3,5-dichloro-N-[(3,5-dibromo-4-methoxyphenyl)methyl]-4-fluoroaniline (PubChem CID 107572617) has the molecular formula C14H10Br2Cl2FNO and a molecular weight of 457.95 g/mol. Its IUPAC name is 3,5-dichloro-N-[(3,5-dibromo-4-methoxyphenyl)methyl]-4-fluoroaniline.
| Compound Name | 3,5-dichloro-N-[(3,5-dibromo-4-methoxyphenyl)methyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 107572617 |
| Molecular Formula | C14H10Br2Cl2FNO |
| Molecular Weight | 457.95 g/mol |
| Exact Mass | 454.85 |
| IUPAC Name | 3,5-dichloro-N-[(3,5-dibromo-4-methoxyphenyl)methyl]-4-fluoroaniline |
| SMILES | COc1c(Br)cc(CNc2cc(Cl)c(F)c(Cl)c2)cc1Br |
| InChI | InChI=1S/C14H10Br2Cl2FNO/c1-21-14-9(15)2-7(3-10(14)16)6-20-8-4-11(17)13(19)12(18)5-8/h2-5,20H,6H2,1H3 |
| InChIKey | CJXBSMGBUYPBMX-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.95 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|