C15H14Cl2FNO2 — CID 107572862
3,5-dichloro-N-[(3,5-dimethoxyphenyl)methyl]-4-fluoroaniline (PubChem CID 107572862) has the molecular formula C15H14Cl2FNO2 and a molecular weight of 330.19 g/mol. Its IUPAC name is 3,5-dichloro-N-[(3,5-dimethoxyphenyl)methyl]-4-fluoroaniline.
| Compound Name | 3,5-dichloro-N-[(3,5-dimethoxyphenyl)methyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 107572862 |
| Molecular Formula | C15H14Cl2FNO2 |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 3,5-dichloro-N-[(3,5-dimethoxyphenyl)methyl]-4-fluoroaniline |
| SMILES | COc1cc(CNc2cc(Cl)c(F)c(Cl)c2)cc(OC)c1 |
| InChI | InChI=1S/C15H14Cl2FNO2/c1-20-11-3-9(4-12(7-11)21-2)8-19-10-5-13(16)15(18)14(17)6-10/h3-7,19H,8H2,1-2H3 |
| InChIKey | HFSRZJXGFNCPQF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|