C16H16Cl2FNO — CID 107572877
3,5-dichloro-4-fluoro-N-[(4-propan-2-yloxyphenyl)methyl]aniline (PubChem CID 107572877) has the molecular formula C16H16Cl2FNO and a molecular weight of 328.21 g/mol. Its IUPAC name is 3,5-dichloro-4-fluoro-N-[(4-propan-2-yloxyphenyl)methyl]aniline.
| Compound Name | 3,5-dichloro-4-fluoro-N-[(4-propan-2-yloxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 107572877 |
| Molecular Formula | C16H16Cl2FNO |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 3,5-dichloro-4-fluoro-N-[(4-propan-2-yloxyphenyl)methyl]aniline |
| SMILES | CC(C)Oc1ccc(CNc2cc(Cl)c(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H16Cl2FNO/c1-10(2)21-13-5-3-11(4-6-13)9-20-12-7-14(17)16(19)15(18)8-12/h3-8,10,20H,9H2,1-2H3 |
| InChIKey | WIKWGXUEKWRTOQ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|