C14H12Cl2FNO2 — CID 107572501
4-[(3,5-dichloro-4-fluoroanilino)methyl]-2-methoxyphenol (PubChem CID 107572501) has the molecular formula C14H12Cl2FNO2 and a molecular weight of 316.16 g/mol. Its IUPAC name is 4-[(3,5-dichloro-4-fluoroanilino)methyl]-2-methoxyphenol.
| Compound Name | 4-[(3,5-dichloro-4-fluoroanilino)methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 107572501 |
| Molecular Formula | C14H12Cl2FNO2 |
| Molecular Weight | 316.16 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 4-[(3,5-dichloro-4-fluoroanilino)methyl]-2-methoxyphenol |
| SMILES | COc1cc(CNc2cc(Cl)c(F)c(Cl)c2)ccc1O |
| InChI | InChI=1S/C14H12Cl2FNO2/c1-20-13-4-8(2-3-12(13)19)7-18-9-5-10(15)14(17)11(16)6-9/h2-6,18-19H,7H2,1H3 |
| InChIKey | RXRZZOMAABKUPJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.16 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|