C15H16ClNO4 — CID 107678634
4-[(3-chloro-4-hydroxyanilino)methyl]-2,6-dimethoxyphenol (PubChem CID 107678634) has the molecular formula C15H16ClNO4 and a molecular weight of 309.75 g/mol. Its IUPAC name is 4-[(3-chloro-4-hydroxyanilino)methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(3-chloro-4-hydroxyanilino)methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 107678634 |
| Molecular Formula | C15H16ClNO4 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-[(3-chloro-4-hydroxyanilino)methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(CNc2ccc(O)c(Cl)c2)cc(OC)c1O |
| InChI | InChI=1S/C15H16ClNO4/c1-20-13-5-9(6-14(21-2)15(13)19)8-17-10-3-4-12(18)11(16)7-10/h3-7,17-19H,8H2,1-2H3 |
| InChIKey | CLKCUVJVOBIRCQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|