C15H16ClNO3 — CID 28615702
4-[(3-chloroanilino)methyl]-2,6-dimethoxyphenol (PubChem CID 28615702) has the molecular formula C15H16ClNO3 and a molecular weight of 293.75 g/mol. Its IUPAC name is 4-[(3-chloroanilino)methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(3-chloroanilino)methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 28615702 |
| Molecular Formula | C15H16ClNO3 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 4-[(3-chloroanilino)methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(CNc2cccc(Cl)c2)cc(OC)c1O |
| InChI | InChI=1S/C15H16ClNO3/c1-19-13-6-10(7-14(20-2)15(13)18)9-17-12-5-3-4-11(16)8-12/h3-8,17-18H,9H2,1-2H3 |
| InChIKey | DGRHJRWZHZRCEG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |