C12H11Br2NOS — CID 66352992
N-[(3,5-dibromo-4-methoxyphenyl)methyl]thiophen-3-amine (PubChem CID 66352992) has the molecular formula C12H11Br2NOS and a molecular weight of 377.10 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-methoxyphenyl)methyl]thiophen-3-amine.
| Compound Name | N-[(3,5-dibromo-4-methoxyphenyl)methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66352992 |
| Molecular Formula | C12H11Br2NOS |
| Molecular Weight | 377.10 g/mol |
| Exact Mass | 374.89 |
| IUPAC Name | N-[(3,5-dibromo-4-methoxyphenyl)methyl]thiophen-3-amine |
| SMILES | COc1c(Br)cc(CNc2ccsc2)cc1Br |
| InChI | InChI=1S/C12H11Br2NOS/c1-16-12-10(13)4-8(5-11(12)14)6-15-9-2-3-17-7-9/h2-5,7,15H,6H2,1H3 |
| InChIKey | OKOXBORCDHXWEF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.10 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |