C13H15NS — CID 66349713
N-[(3,4-dimethylphenyl)methyl]thiophen-3-amine (PubChem CID 66349713) has the molecular formula C13H15NS and a molecular weight of 217.34 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)methyl]thiophen-3-amine.
| Compound Name | N-[(3,4-dimethylphenyl)methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66349713 |
| Molecular Formula | C13H15NS |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N-[(3,4-dimethylphenyl)methyl]thiophen-3-amine |
| SMILES | Cc1ccc(CNc2ccsc2)cc1C |
| InChI | InChI=1S/C13H15NS/c1-10-3-4-12(7-11(10)2)8-14-13-5-6-15-9-13/h3-7,9,14H,8H2,1-2H3 |
| InChIKey | NJQCSIWEDWYFHL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |