C12H14N2S — CID 63247673
4-methyl-1-N-(thiophen-3-ylmethyl)benzene-1,3-diamine (PubChem CID 63247673) has the molecular formula C12H14N2S and a molecular weight of 218.33 g/mol. Its IUPAC name is 4-methyl-1-N-(thiophen-3-ylmethyl)benzene-1,3-diamine.
| Compound Name | 4-methyl-1-N-(thiophen-3-ylmethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 63247673 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4-methyl-1-N-(thiophen-3-ylmethyl)benzene-1,3-diamine |
| SMILES | Cc1ccc(NCc2ccsc2)cc1N |
| InChI | InChI=1S/C12H14N2S/c1-9-2-3-11(6-12(9)13)14-7-10-4-5-15-8-10/h2-6,8,14H,7,13H2,1H3 |
| InChIKey | UTKZTRFGAIFFLL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|