C13H16N2O2S2 — CID 43717517
N,2-dimethyl-5-(thiophen-3-ylmethylamino)benzenesulfonamide (PubChem CID 43717517) has the molecular formula C13H16N2O2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is N,2-dimethyl-5-(thiophen-3-ylmethylamino)benzenesulfonamide.
| Compound Name | N,2-dimethyl-5-(thiophen-3-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 43717517 |
| Molecular Formula | C13H16N2O2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | N,2-dimethyl-5-(thiophen-3-ylmethylamino)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(NCc2ccsc2)ccc1C |
| InChI | InChI=1S/C13H16N2O2S2/c1-10-3-4-12(7-13(10)19(16,17)14-2)15-8-11-5-6-18-9-11/h3-7,9,14-15H,8H2,1-2H3 |
| InChIKey | HPJCRUAXVZPNKZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |