C15H18N2O3S — CID 43717522
5-[(2-hydroxyphenyl)methylamino]-N,2-dimethylbenzenesulfonamide (PubChem CID 43717522) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 5-[(2-hydroxyphenyl)methylamino]-N,2-dimethylbenzenesulfonamide.
| Compound Name | 5-[(2-hydroxyphenyl)methylamino]-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 43717522 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 5-[(2-hydroxyphenyl)methylamino]-N,2-dimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(NCc2ccccc2O)ccc1C |
| InChI | InChI=1S/C15H18N2O3S/c1-11-7-8-13(9-15(11)21(19,20)16-2)17-10-12-5-3-4-6-14(12)18/h3-9,16-18H,10H2,1-2H3 |
| InChIKey | XGSIWYDFZRKSAF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|