C19H25N — CID 43758536
4-tert-butyl-N-[(3,4-dimethylphenyl)methyl]aniline (PubChem CID 43758536) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 4-tert-butyl-N-[(3,4-dimethylphenyl)methyl]aniline.
| Compound Name | 4-tert-butyl-N-[(3,4-dimethylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 43758536 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 4-tert-butyl-N-[(3,4-dimethylphenyl)methyl]aniline |
| SMILES | Cc1ccc(CNc2ccc(C(C)(C)C)cc2)cc1C |
| InChI | InChI=1S/C19H25N/c1-14-6-7-16(12-15(14)2)13-20-18-10-8-17(9-11-18)19(3,4)5/h6-12,20H,13H2,1-5H3 |
| InChIKey | CEDZESHKKIOLNX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |