C16H17Br2NO2 — CID 106953832
4-[(3,5-dibromo-4-methoxyphenyl)methylamino]-2,5-dimethylphenol (PubChem CID 106953832) has the molecular formula C16H17Br2NO2 and a molecular weight of 415.13 g/mol. Its IUPAC name is 4-[(3,5-dibromo-4-methoxyphenyl)methylamino]-2,5-dimethylphenol.
| Compound Name | 4-[(3,5-dibromo-4-methoxyphenyl)methylamino]-2,5-dimethylphenol |
|---|---|
| PubChem CID | 106953832 |
| Molecular Formula | C16H17Br2NO2 |
| Molecular Weight | 415.13 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | 4-[(3,5-dibromo-4-methoxyphenyl)methylamino]-2,5-dimethylphenol |
| SMILES | COc1c(Br)cc(CNc2cc(C)c(O)cc2C)cc1Br |
| InChI | InChI=1S/C16H17Br2NO2/c1-9-5-15(20)10(2)4-14(9)19-8-11-6-12(17)16(21-3)13(18)7-11/h4-7,19-20H,8H2,1-3H3 |
| InChIKey | LVGFGEULMYCEHF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.13 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|