C15H14Br2INO — CID 43785217
N-[(3,5-dibromo-4-methoxyphenyl)methyl]-4-iodo-2-methylaniline (PubChem CID 43785217) has the molecular formula C15H14Br2INO and a molecular weight of 511.00 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-methoxyphenyl)methyl]-4-iodo-2-methylaniline.
| Compound Name | N-[(3,5-dibromo-4-methoxyphenyl)methyl]-4-iodo-2-methylaniline |
|---|---|
| PubChem CID | 43785217 |
| Molecular Formula | C15H14Br2INO |
| Molecular Weight | 511.00 g/mol |
| Exact Mass | 508.85 |
| IUPAC Name | N-[(3,5-dibromo-4-methoxyphenyl)methyl]-4-iodo-2-methylaniline |
| SMILES | COc1c(Br)cc(CNc2ccc(I)cc2C)cc1Br |
| InChI | InChI=1S/C15H14Br2INO/c1-9-5-11(18)3-4-14(9)19-8-10-6-12(16)15(20-2)13(17)7-10/h3-7,19H,8H2,1-2H3 |
| InChIKey | QFOVBNYTXGFJAT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.00 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|