C18H11N5O — CID 91317473
4-(5-cyano-3-pyridinyl)-2-imino-4,9-dihydro-3H-pyrano[3,2-g]indole-3-carbonitrile (PubChem CID 91317473) has the molecular formula C18H11N5O and a molecular weight of 313.32 g/mol. Its IUPAC name is 4-(5-cyano-3-pyridinyl)-2-imino-4,9-dihydro-3H-pyrano[3,2-g]indole-3-carbonitrile.
| Compound Name | 4-(5-cyano-3-pyridinyl)-2-imino-4,9-dihydro-3H-pyrano[3,2-g]indole-3-carbonitrile |
|---|---|
| PubChem CID | 91317473 |
| Molecular Formula | C18H11N5O |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 4-(5-cyano-3-pyridinyl)-2-imino-4,9-dihydro-3H-pyrano[3,2-g]indole-3-carbonitrile |
| SMILES | [H]/N=C1\Oc2c(ccc3cc[nH]c23)C(c2cncc(C#N)c2)C1C#N |
| InChI | InChI=1S/C18H11N5O/c19-6-10-5-12(9-22-8-10)15-13-2-1-11-3-4-23-16(11)17(13)24-18(21)14(15)7-20/h1-5,8-9,14-15,21,23H/b21-18- |
| InChIKey | ABYVBVUICULPGX-UZYVYHOESA-N |
| XLogP | 3.08 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|